Room 902&917, Hua Teng Bei Tang Business Plaza, No.37 Nan Mo Fang Road, ChaoYang District. Bei Jing, China:86 188 1097 1621

Product Description

2-(4-Nitrophenyl)butyric acid CAS 7463-53-8

  • 7463-53-8
  • Entrepreneur
  • White powder
  • 95% Min

Product Name: 2-(4-Nitrophenyl)butyric acid
Cas No.: 7463-53-8
Molecular Formula: C10H11NO4
Molecular Weight: 209.20
Appearance: White powder
Density: 1.287
Purity: 95% Min
Solubility: Soluble in methanol, ethanol, acetone and chloroform.
Boiling point: 371.2°C at 760mmHg
Melting point: 122-123 oC
Flash point: 161.6 oC
Vapour: 0.0±0.9 mmHg at 25℃
Refractive index: 1.568
SMILES: C(C(O)=O)(CC)C1=CC=C(N(=O)=O)C=C1
InChI Key: InChIKey=XBGNOMBPRQVJSR-UHFFFAOYSA-N
Other names: 2-(p-Nitrophenyl)butyric acid / NSC 68215 / NSC 404387

Description:

2-(4-Nitrophenyl)butyric acid, also known as 2-(p-Nitrophenyl)butyric acid, NSC 68215 or NSC 404387, is a key intermediate in the synthesis of indobufen, a new generation of anti-platelet aggregation agents. It is an organic compound that belongs to the class of aromatic carboxylic acids. The compound features a nitrophenyl group attached to a butyric acid backbone. It is commonly used as a building block or intermediate in organic synthesis and pharmaceutical research. The nitrophenyl group provides reactivity and versatility, allowing for various chemical transformations and functional group modifications. The compound has applications in the synthesis of pharmaceuticals, dyes, and other fine chemicals. Its unique structure and properties make it a valuable tool in organic chemistry and drug discovery processes.

Features:

1. Molecular Structure: It consists of a butyric acid backbone with a p-nitrophenyl group attached to it. The presence of the nitro group imparts specific characteristics to the compound.
2. Solid State: It exists as a yellow crystalline solid at room temperature. The solid form allows for convenient handling and storage.
3. Chemical Reactivity: The compound exhibits reactivity due to the presence of functional groups, such as the carboxylic acid and nitrophenyl moieties. This reactivity enables it to participate in various chemical reactions and serve as a building block for the synthesis of more complex compounds.
4. Solubility: 2-(p-Nitrophenyl)butyric acid is sparingly soluble in water but dissolves well in organic solvents like ethanol, methanol, and acetone.
5. Stability: It is relatively stable under normal conditions, but it may undergo degradation or decomposition when exposed to extreme heat, light, or strong acids or bases.

Applications:

1. Pharmaceutical Intermediate
2-(p-Nitrophenyl)butyric acid is a key intermediate in the synthesis of indobufen, a new generation of anti-platelet aggregation agents.
2. Pharmaceutical Research
It serves as a building block in the synthesis of pharmaceutical compounds. Its structure and reactivity make it valuable for introducing specific functional groups or modifying existing molecules to enhance their biological activity.
3. Organic Synthesis
The compound is employed in organic chemistry laboratories as a starting material or intermediate for the synthesis of diverse organic compounds. It can be used to create complex molecules with tailored properties.
4. Fine Chemicals
2-(p-Nitrophenyl)butyric acid is utilized in the production of fine chemicals, which are substances used in various industries such as cosmetics, food additives, and specialty chemicals. It can be incorporated into formulations to impart specific properties or functions.
5. Dye Synthesis
The compound finds application in the synthesis of dyes and pigments. It can be used as a precursor or intermediate in the production of colored compounds for various applications, including textiles, printing inks, and coatings.
6. Research and Development
Due to its unique structure and reactivity, 2-(p-Nitrophenyl)butyric acid is valuable for research purposes. It can be utilized in studies investigating chemical reactions, exploring new synthetic routes, and developing novel compounds with potential applications.

Storage: Store in a well-ventilated area. Keep the container tightly sealed.

Package: 25kg/bag or as per your particular request.